| Identification | |
| Name: | Benzenamine,4-[2-(2-benzothiazolyl)ethenyl]-N,N-dimethyl- |
| Synonyms: | Benzothiazole,2-[p-(dimethylamino)styryl]- (6CI,7CI,8CI);2-(4-Dimethylaminostyryl)benzothiazole; 2-(p-Dimethylaminostyryl)benzothiazole;N 276; NK 1819; NSC 402471 |
| CAS: | 1628-58-6 |
| EINECS: | 216-622-2 |
| Molecular Formula: | C17H16 N2 S |
| Molecular Weight: | 280.41 |
| InChI: | InChI=1/C17H16N2S/c1-19(2)14-10-7-13(8-11-14)9-12-17-18-15-5-3-4-6-16(15)20-17/h3-12H,1-2H3/b12-9+ |
| Molecular Structure: | ![(C17H16N2S) Benzothiazole,2-[p-(dimethylamino)styryl]- (6CI,7CI,8CI);2-(4-Dimethylaminostyryl)benzothiazole; 2-(...](https://img1.guidechem.com/chem/e/dict/33/1628-58-6.jpg) |
| Properties | |
| Flash Point: | 239.9°C |
| Boiling Point: | 473.1°C at 760 mmHg |
| Density: | 1.232g/cm3 |
| Refractive index: | 1.745 |
| Specification: |
Electrochemical and chemical oxidation methods have been used to understand the extent to which2-(p-(Dimethylamino)styryl)benzo-thiazole (CAS NO.1628-58-6) gets encapsulated in the cyclodextrin cavities. The guest molecule can induce the formation of nanocapsules with cyclodextrin hosts due to hydrophobic interaction leading to the formation of nanotubes followed by suprastructures. The electrochemically obtained results were confirmed using chemical method. |
| Report: |
Reported in EPA TSCA Inventory. |
| Flash Point: | 239.9°C |
| Safety Data | |
 |
|
