| Identification | |
| Name: | 1-Butanone,1,2-diphenyl- |
| Synonyms: | 1,2-Diphenyl-1-butanone;NSC 168889;a-Phenylbutyrophenone; |
| CAS: | 16282-16-9 |
| Molecular Formula: | C16H16O |
| Molecular Weight: | 224.31 |
| InChI: | InChI=1S/C16H16O/c1-2-15(13-9-5-3-6-10-13)16(17)14-11-7-4-8-12-14/h3-12,15H,2H2,1H3 |
| Molecular Structure: |  |
| Properties | |
| Melting Point: | 53-56 ºC |
| Flash Point: | 144 ºC |
| Boiling Point: | 338.5 ºC at 760 mmHg |
| Density: | 1.041 g/cm3 |
| Specification: |
1-Butanone,1,2-diphenyl- , its cas register number is 16282-16-9. It also can be called 1,2-Diphenyl-butan-1-one ; and alpha-Ethyl deoxybenzoin . |
| Flash Point: | 144 ºC |
| Safety Data | |
 |
|
