| Identification | |
| Name: | 1-Penten-3-one |
| Synonyms: | 4-Penten-3-one;Ethyl vinyl ketone;NSC 81211;Vinyl ethyl ketone; |
| CAS: | 1629-58-9 |
| EINECS: | 216-624-3 |
| Molecular Formula: | C5H8O |
| Molecular Weight: | 84.12 |
| InChI: | InChI=1/C5H8O/c1-3-5(6)4-2/h3H,1,4H2,2H3 |
| Molecular Structure: |  |
| Properties | |
| Transport: | UN 3286 |
| Density: | 0.845 |
| Refractive index: | 1.419 |
| Water Solubility: | insoluble in water; soluble in most organic solvents |
| Solubility: | insoluble in water; soluble in most organic solvents |
| Appearance: | clear colorless to amber liquid |
| Specification: |
1-Penten-3-one ,its cas register number is 1629-58-9. It also can be called Methyl butenone ; and Ethylacrolein . |
| Report: |
Reported in EPA TSCA Inventory. |
| Packinggroup: | II |
| Storage Temperature: | 2-8°C |
| Safety Data | |
| Hazard Symbols |
F:Flammable
T:Toxic
|
 |
|
