| Identification | |
| Name: | Diazene, 1,2-diethyl-,2-oxide |
| Synonyms: | Azoxyethane(7CI,8CI); Diazene, diethyl-, 1-oxide (9CI) |
| CAS: | 16301-26-1 |
| Molecular Formula: | C4H10 N2 O |
| Molecular Weight: | 102.16 |
| InChI: | InChI=1/C4H10N2O/c1-3-5-6(7)4-2/h3-4H2,1-2H3/b6-5- |
| Molecular Structure: |  |
| Properties | |
| Flash Point: | 39.1°C |
| Boiling Point: | 141°C at 760 mmHg |
| Density: | 0.95g/cm3 |
| Refractive index: | 1.442 |
| Specification: |
Azoxyethane with cas registry number of 16301-26-1 is also called for Azoxyaethan ; Azoxyaethan [German] ; CCRIS 66 ; Diazene, diethyl-, 1-oxide ; Ethane, azoxy- ; HSDB 5120 . |
| Flash Point: | 39.1°C |
| Safety Data | |
 |
|
