| Identification | |
| Name: | EEDQ |
| Synonyms: | Ethyl 1,2-dihydro-2-ethoxy-1-quinolinecarboxylate; N-Ethoxycarbonyl-2-ethoxy-1,2-dihydroquinoline; EEDQ~N-Ethoxycarbonyl-2-ethoxy-1,2-dihydroquinoline; 2-Ethoxy-1-ethoxycarbonyl-1,2-dihydroquinoline; ethyl N-(2-ethoxy-1,2-dihydroquinoline)carboxylate; 1,2-Dihydro-2-ethoxy-1-quinolinecarboxylic acid e |
| CAS: | 16357-59-8 |
| EINECS: | 240-418-2 |
| Molecular Formula: | C14H17NO3 |
| Molecular Weight: | 247.29 |
| InChI: | InChI=1/C14H17NO3/c1-3-17-13-10-9-11-7-5-6-8-12(11)15(13)14(16)18-4-2/h5-10,13H,3-4H2,1-2H3 |
| Molecular Structure: |  |
| Properties | |
| Transport: | 20kgs |
| Density: | 1.16 g/cm3 |
| Stability: | Stable under normal temperatures and pressures. |
| Refractive index: | 1.564 |
| Water Solubility: | insoluble |
| Solubility: | Insoluble |
| Appearance: | white to off-white powder |
| HS Code: | 29334990 |
| Storage Temperature: | 2-8°C |
| Sensitive: | Moisture Sensitive |
| Safety Data | |
| Hazard Symbols |
Xn:Harmful
|
 |
|
