| Identification | |
| Name: | 5H-Pyrrolo[2,3-d]pyrimidine,4-chloro-6,7-dihydro- |
| Synonyms: | 5H-pyrrolo[2,3-d]pyrimidine, 4-chloro-6,7-dihydro-; |
| CAS: | 16372-08-0 |
| Molecular Formula: | C6H6ClN3 |
| Molecular Weight: | 0 |
| InChI: | InChI=1/C6H6ClN3/c7-5-4-1-2-8-6(4)10-3-9-5/h3H,1-2H2,(H,8,9,10) |
| Molecular Structure: | ![(C6H6ClN3) 5H-pyrrolo[2,3-d]pyrimidine, 4-chloro-6,7-dihydro-;](https://img1.guidechem.com/chem/e/dict/13/16372-08-0.jpg) |
| Properties | |
| Density: | 1.377 g/cm3 |
| Refractive index: | 1.592 |
| Specification: |
The 4-Chloro-6,7-dihydro-5H-pyrrolo[2,3-d]pyrimidine with the cas number 16372-08-0 is also called 5H-pyrrolo[2,3-d]pyrimidine, 4-chloro-6,7-dihydro-. The molecular formula of this chemical is C6H6ClN3. This chemical is a kind of organics. It should be stored in dry and cool environment. The properties of the chemical are: (1)ACD/LogP: 0.41; (2)# of Rule of 5 Violations: 0; (3)ACD/LogD (pH 5.5): 0.41; (4)ACD/LogD (pH 7.4): 0.41; (5)#H bond acceptors: 3; (6)#H bond donors: 1; (7)#Freely Rotating Bonds: 0; (8)Polar Surface Area: 37.81Å2; (9)Index of Refraction: 1.592; (10)Molar Refractivity: 38.24 cm3; (11)Molar Volume: 112.9 cm3; (12)Polarizability: 15.15×10-24cm3; (13)Surface Tension: 57 dyne/cm; (14)Enthalpy of Vaporization: 55.29 kJ/mol; (15)Vapour Pressure: 0.000546 mmHg at 25°C. You can still convert the following datas into molecular structure: |
| Safety Data | |
 |
|
