Identification |
Name: | Adenosine, 2'-deoxy-,hydrate (1:1) |
Synonyms: | Adenosine,2'-deoxy-, monohydrate (8CI,9CI);Deoxyadenosinemonohydrate; |
CAS: | 16373-93-6 |
EINECS: | 213-488-7 |
Molecular Formula: | C10H13N5O3.H2O |
Molecular Weight: | 269.26 |
InChI: | InChI=1/C10H13N5O3/c11-9-8-10(13-3-12-9)15(4-14-8)7-1-5(17)6(2-16)18-7/h3-7,16-17H,1-2H2,(H2,11,12,13)/t5-,6+,7+/m0/s1 |
Molecular Structure: |
|
Properties |
Transport: | UN2811 6.1/PG 3 |
Density: | 1.91g/cm3 |
Stability: | Stable, but air sensitive. Incompatible with strong oxidizing agents. |
Refractive index: | -25.5 ° (C=0.5, H2O) |
Solubility: | 0.3 g/100 mL (20 ºC) |
Appearance: | powder |
Specification: |
9-(2'-Deoxy-beta-D-erythro-pentofuranosyl)adenine , its CAS NO. is 16373-93-6, the synonyms are 2'-dA ; 2'-Deoxyadenosine .
|
Storage Temperature: | 2-8°C |
Safety Data |
Hazard Symbols |
Xn: Harmful
|
|
|