Identification |
Name: | Benz[7,8]indolizino[2,3-b]quinoxaline,5,6-dihydro-2,3-dimethoxy-6,6-dimethyl- |
Synonyms: | YM 90709 |
CAS: | 163769-88-8 |
Molecular Formula: | C22H21 N3 O2 |
Molecular Weight: | 359.42 |
InChI: | InChI=1/C22H21N3O2/c1-22(2)12-13-9-19(26-3)20(27-4)10-14(13)18-11-17-21(25(18)22)24-16-8-6-5-7-15(16)23-17/h5-11H,12H2,1-4H3 |
Molecular Structure: |
 |
Properties |
Flash Point: | 304.3°C |
Boiling Point: | 579.6°Cat760mmHg |
Density: | 1.28g/cm3 |
Refractive index: | 1.666 |
Biological Activity: | Novel, selective inhibitor of interleukin-5 (IL-5) binding to its receptor (IC 50 = 0.45-1 mM). Inhibits IL-5-prolonged eosinophil survival and IL-5-induced tyrosine phosphorylation of JAK2 without inhibiting GM-CSF-mediated effects. In vivo, inhibits antigen-induced eosinophil and lymphocyte recruitment in rat airways, without affecting peripheral blood or bone marrow leukocytes. |
Flash Point: | 304.3°C |
Safety Data |
|
 |