| Identification | |
| Name: | Phenol, 4-butyl- |
| Synonyms: | NSC 407848;p-Butylphenol;p-Hydroxy-n-butylbenzene;p-Hydroxybutylbenzene;p-n-Butylphenol;Phenol,p-butyl- (6CI,7CI,8CI);1-(p-Hydroxyphenyl)butane;4-n-Butylphenol; |
| CAS: | 1638-22-8 |
| EINECS: | 216-672-5 |
| Molecular Formula: | C10H14O |
| Molecular Weight: | 150.22 |
| InChI: | InChI=1/C10H14O/c1-2-3-4-9-5-7-10(11)8-6-9/h5-8,11H,2-4H2,1H3 |
| Molecular Structure: |  |
| Properties | |
| Transport: | 3145 |
| Melting Point: | 22°C |
| Flash Point: | 121.5°C |
| Boiling Point: | 138-139°C 18mm |
| Density: | 0.98 |
| Stability: | Stable at room temperature in closed containers under normal storage and handling conditions. |
| Refractive index: | 1.5170 |
| Solubility: | Insoluble |
| Appearance: | Liquid. |
| Specification: | usageEng:Intermediates of Liquid Crystals Safety Statements:26-36/37/39-45 26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice 36/37/39:Wear suitable protective clothing, gloves and eye/face protection 45:In case of accident or if you feel unwell, seek medical advice immediately (show label where possible) |
| Report: |
Reported in EPA TSCA Inventory. |
| Packinggroup: | III |
| Flash Point: | 121.5°C |
| Storage Temperature: | Keep container closed when not in use. Store in a tightly closed container. Store in a cool, dry, well-ventilated area away from incompatible substances. Corrosives area. |
| Usage: | Intermediates of Liquid Crystals |
| Safety Data | |
 |
|
