| Identification | |
| Name: | 1H-Indole-2-carboxylicacid, 5-methyl-, ethyl ester |
| Synonyms: | Indole-2-carboxylicacid, 5-methyl-, ethyl ester (6CI,8CI);5-Methyl-1H-indole-2-carboxylic acidethyl ester;Ethyl 5-methyl-1H-indole-2-carboxylate;Ethyl5-methylindole-2-carboxylate;NSC 30928; |
| CAS: | 16382-15-3 |
| Molecular Formula: | C12H13NO2 |
| Molecular Weight: | 203.24 |
| InChI: | InChI=1/C12H13NO2/c1-3-15-12(14)11-7-9-6-8(2)4-5-10(9)13-11/h4-7,13H,3H2,1-2H3 |
| Molecular Structure: |  |
| Properties | |
| Density: | 1.177g/cm3 |
| Refractive index: | 1.609 |
| Specification: |
The Ethyl 5-methylindole-2-carboxylate with its cas register number is 16382-15-3. It also can be called as 5-Methyl-1H-indole-2-carboxylic acid ethyl ester and the IUPAC Name about this chemical is ethyl 5-methyl-1H-indole-2-carboxylate. It belongs to the following product categories, such as Indoles and derivatives, Indole, Building Blocks, Heterocyclic Building Blocks, Indoles and so on. When you are using it, please not breathe dust and avoid contact with skin and eyes. Physical properties about Ethyl 5-methylindole-2-carboxylate are: (1)ACD/LogP: 3.56; (2)#H bond acceptors: 3; (3)#H bond donors: 1; (4)#Freely Rotating Bonds: 3; (5)Polar Surface Area: 31.23Å2; (6)Index of Refraction: 1.609; (7)Molar Refractivity: 59.75 cm3; (8)Molar Volume: 172.5 cm3; (9)Polarizability: 23.69x10-24cm3; (10)Surface Tension: 47.5 dyne/cm; (11)Enthalpy of Vaporization: 60.18 kJ/mol; (12)Vapour Pressure: 2.9E-05 mmHg at 25°C. You can still convert the following datas into molecular structure: |
| Safety Data | |
 |
|
