| Identification | |
| Name: | o-Phenylene phosphorochloridite |
| Synonyms: | 1,2-Phenylene phosphorochloridite; Catechyl phosphorus chloride; 2-Chloro-1,3,2-benzodioxaphosphole |
| CAS: | 1641-40-3 |
| EINECS: | 216-690-3 |
| Molecular Formula: | C6H4ClO2P |
| Molecular Weight: | 174.52 |
| InChI: | InChI=1/C6H4ClO2P/c7-10-8-5-3-1-2-4-6(5)9-10/h1-4H |
| Molecular Structure: |  |
| Properties | |
| Transport: | UN 3261 8/PG 2 |
| Flash Point: | 64.1°C |
| Density: | 1.46 |
| Stability: | Moisture Sensitive |
| Refractive index: | n20/D 1.571(lit.) |
| Specification: | Colourless Liquid Which Solidifies at Low Temperature usageEng:Highly reactive cyclic phosphitylating reagent which provides fast coupling rates, and hydrolytic cleavage occurs more readily than with acyclic analogs Safety Statements:26-36/37/39-45 26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice 36/37/39:Wear suitable protective clothing, gloves and eye/face protection 45:In case of accident or if you feel unwell, seek medical advice immediately (show label where possible) |
| Packinggroup: | II |
| Flash Point: | 64.1°C |
| Storage Temperature: | 0-6°C |
| Sensitive: | Moisture Sensitive |
| Usage: | Highly reactive cyclic phosphitylating reagent which provides fast coupling rates, and hydrolytic cleavage occurs more readily than with acyclic analogs |
| Safety Data | |
| Hazard Symbols |
C:Corrosive
|
 |
|
