| Identification | |
| Name: | Benzonitrile,3-isocyanato- |
| Synonyms: | Benzonitrile,m-isocyanato- (5CI);Isocyanic acid, m-cyanophenyl ester (8CI);3-Cyanophenylisocyanate;3-Isocyanatobenzonitrile;m-Cyanophenyl isocyanate; |
| CAS: | 16413-26-6 |
| Molecular Formula: | C8H4N2O |
| Molecular Weight: | 144.13 |
| InChI: | InChI=1/C8H4N2O/c9-5-7-2-1-3-8(4-7)10-6-11/h1-4H |
| Molecular Structure: |  |
| Properties | |
| Transport: | HAZARD |
| Flash Point: | 32 C |
| Boiling Point: | 246.2°Cat760mmHg |
| Density: | 1.09g/cm3 |
| Refractive index: | 1.562 |
| Appearance: | whit yellowish crystalline solid |
| Specification: |
It is sensitive to air and moisture and it should avoid incompatible materials such as strong Oxidizing agents ,strong acids,exposure to air and avoid exposure to moist air or water.Its decomposition products is: Nitrogen oxides , carbon monoxide , carbon dioxide.Its hazardous polymerization will not occur. |
| Packinggroup: | II |
| Flash Point: | 32 C |
| Sensitive: | Moisture Sensitive |
| Safety Data | |
| Hazard Symbols |
Xn:Harmful
|
 |
|
