| Identification | |
| Name: | 4-(Chloromethyl)benzoic acid |
| Synonyms: | alpha-chloro-P-toluylic acid; 4-Chloromethhhylbenzoic acid; alpa-Chloro-p-toluic acid; p-(Chloromethyl) benzoic acid; |
| CAS: | 1642-81-5 |
| EINECS: | 216-697-1 |
| Molecular Formula: | C8H7ClO2 |
| Molecular Weight: | 170.59 |
| InChI: | InChI=1/C8H7ClO2/c9-5-6-1-3-7(4-2-6)8(10)11/h1-4H,5H2,(H,10,11) |
| Molecular Structure: |  |
| Properties | |
| Transport: | UN 3261 |
| Flash Point: | 145.9°C |
| Boiling Point: | 317.7°Cat760mmHg |
| Density: | 1.315g/cm3 |
| Appearance: | white crystalline powder |
| Specification: | White to slightly yellow crystalline powder Safety Statements:26-36/37/39-45-22-27 26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice 36/37/39:Wear suitable protective clothing, gloves and eye/face protection 45:In case of accident or if you feel unwell, seek medical advice immediately (show label where possible) 22:Do not breathe dust 27:Take off immediately all contaminated clothing |
| Packinggroup: | III |
| Flash Point: | 145.9°C |
| Storage Temperature: | 2-8°C |
| Sensitive: | Moisture Sensitive |
| Safety Data | |
| Hazard Symbols |
C:Corrosive
|
 |
|
