| Identification | |
| Name: | Benzenepropanoic acid,2-chloro- |
| Synonyms: | 2-Chlorobenzenepropanoic acid; |
| CAS: | 1643-28-3 |
| EINECS: | -0 |
| Molecular Formula: | C9H9ClO2 |
| Molecular Weight: | 184.62 |
| InChI: | InChI=1/C9H9ClO2/c10-8-4-2-1-3-7(8)5-6-9(11)12/h1-4H,5-6H2,(H,11,12) |
| Molecular Structure: |  |
| Properties | |
| Density: | 1.27 g/cm3 |
| Specification: |
3-(2-Chlorophenyl)Propionic Acid (1643-28-3), which also can be called for: 3-(2-Chlorophenyl)Propanoic Acid ; 3-(2-Chlorophenyl)Propionic Acid ; Rarechem AL BO 0376 ; O-Chlorohydrocinnamic Acid ; 3-(2-Chlorophenyl)Propionic Acid, 98+% ; 2-Chlorobenzenepropanoic Acid ; 2-Chlorobenzenepropionic Acid . 3-(2-Chlorophenyl)Propionic Acid (1643-28-3) can be used for laboratory as chemical reagent. |
| Safety Data | |
| Hazard Symbols |
Xi: Irritant
|
 |
|
