| Identification | |
| Name: | Magnesium,chloro[(4-fluorophenyl)methyl]- (9CI) |
| Synonyms: | Magnesium,chloro(p-fluorobenzyl)- (7CI,8CI);4-Fluorobenzylmagnesium chloride;Chloro(p-fluorobenzyl)magnesium;p-Fluorobenzylmagnesium chloride;p-Fluorophenylmethylmagnesium chloride; |
| CAS: | 1643-73-8 |
| Molecular Formula: | C7H6ClFMg |
| Molecular Weight: | 168.88 |
| InChI: | InChI=1/C7H6F.ClH.Mg/c1-6-2-4-7(8)5-3-6;;/h2-5H,1H2;1H;/q;;+1/p-1/rC7H6ClFMg/c8-10-5-6-1-3-7(9)4-2-6/h1-4H,5H2 |
| Molecular Structure: |  |
| Properties | |
| Transport: | UN 2924 3/PG 2 |
| Appearance: | yellow to orange or brown solution |
| Specification: | Yellow to orange or brown solution Safety Statements:9-16-29-33-45-36/37/39-26-23 9:Keep container in a well-ventilated place 16:Keep away from sources of ignition - No smoking 29:Do not empty into drains 33:Take precautionary measures against static discharges 45:In case of accident or if you feel unwell, seek medical advice immediately (show label where possible) 36/37/39:Wear suitable protective clothing, gloves and eye/face protection 26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice 23:Do not breathe gas/fumes/vapor/spray (appropriate wording to be specified by the manufacturer) |
| Safety Data | |
| Hazard Symbols | |
 |
|
