| Identification | |
| Name: | 1,3-Benzodioxole,2,2-difluoro-5-nitro- |
| Synonyms: | Benzene,1,2-[(difluoromethylene)dioxy]-4-nitro- (7CI,8CI) |
| CAS: | 1645-96-1 |
| Molecular Formula: | C7H3F2NO4 |
| Molecular Weight: | 203.10 |
| InChI: | InChI=1/C7H3F2NO4/c8-7(9)13-5-2-1-4(10(11)12)3-6(5)14-7/h1-3H |
| Molecular Structure: | ![(C7H3F2NO4) Benzene,1,2-[(difluoromethylene)dioxy]-4-nitro- (7CI,8CI)](https://img.guidechem.com/casimg/1645-96-1.gif) |
| Properties | |
| Transport: | UN2810 |
| Flash Point: | 89.4°C |
| Boiling Point: | 224.2°Cat760mmHg |
| Density: | 1.65g/cm3 |
| Refractive index: | 1.55 |
| Specification: | Safety Statements:26-36/37/39 26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice 36/37/39:Wear suitable protective clothing, gloves and eye/face protection |
| Packinggroup: | III |
| Flash Point: | 89.4°C |
| Storage Temperature: | Room temperature. |
| Safety Data | |
 |
|
