Identification |
Name: | Benzamide,4-azido-2-hydroxy-N-[2-(2-pyridinyldithio)ethyl]- |
Synonyms: | 4-azido-2-hydroxy-N-[2-(pyridin-2-yldisulfanyl)ethyl]benzamide |
CAS: | 164575-82-0 |
Molecular Formula: | C14H13 N5 O2 S2 |
Molecular Weight: | 0 |
InChI: | InChI=1/C14H13N5O2S2/c15-19-18-10-4-5-11(12(20)9-10)14(21)17-7-8-22-23-13-3-1-2-6-16-13/h1-6,9,20H,7-8H2,(H,17,21) |
Molecular Structure: |
|
Properties |
Usage: | AET is a radioionatable, cleavable, photoactivable cross linking agent. The maximum length of the linker arm between Ca of the amino acid of interest and the photoreactive atom is 14A. The AET absorbance maxima are:
l max = 273nm; e= 2.6 x 104 ; |
Safety Data |
|
|