| Identification | |
| Name: | Ethanone,1-(2-benzofuranyl)- |
| Synonyms: | Ketone,2-benzofuranyl methyl (6CI,7CI,8CI);1-(2-Benzofuranyl)ethanone;1-(2-Benzofuryl)-1-ethanone;2-Acetylbenzo[b]furan;2-Acetylcoumarone;2-Benzofuranyl methyl ketone;2-Benzofuryl methyl ketone;Benzo[b]furan-2-yl methyl ketone;NSC 23974;NSC 28904; |
| CAS: | 1646-26-0 |
| EINECS: | 216-706-9 |
| Molecular Formula: | C10H8O2 |
| Molecular Weight: | 160.17 |
| InChI: | InChI=1/C10H8O2/c1-7(11)10-6-8-4-2-3-5-9(8)12-10/h2-6H,1H3 |
| Molecular Structure: |  |
| Properties | |
| Flash Point: | 112.8°C |
| Density: | 1.161g/cm3 |
| Refractive index: | 1.588 |
| Appearance: | Colorless to light yellow liquid |
| Specification: | Colorless to light yellow liqui Safety Statements:22-24/25 22:Do not breathe dust 24/25:Avoid contact with skin and eyes |
| HS Code: | 29329985 |
| Flash Point: | 112.8°C |
| Safety Data | |
 |
|
