| Identification | |
| Name: | Propanoic acid,2-methyl-, 2,4-hexadien-1-yl ester |
| Synonyms: | Isobutyricacid, 2,4-hexadienyl ester (8CI); Propanoic acid, 2-methyl-, 2,4-hexadienylester (9CI); 2,4-Hexadien-1-ol, isobutyrate (8CI); 2,4-Hexadienyl isobutyrate;NSC 195147 |
| CAS: | 16491-24-0 |
| EINECS: | 240-551-6 |
| Molecular Formula: | C10H16 O2 |
| Molecular Weight: | 168.26 |
| InChI: | InChI=1/C10H16O2/c1-4-5-6-7-8-12-10(11)9(2)3/h4-7,9H,8H2,1-3H3/b5-4+,7-6+ |
| Molecular Structure: |  |
| Properties | |
| Flash Point: | 85.5°C |
| Boiling Point: | 221.9°Cat760mmHg |
| Density: | 0.91g/cm3 |
| Refractive index: | 1.456 |
| Specification: |
2,4-Hexadienyl isobutyrate ,its cas register number is 16491-24-0. It also can be called 2,4-Hexadienyl 2-methylpropanoate ; Isobutyric acid, 2,4-hexadienyl ester ; and Hexa-2,4-dienyl isobutyrate . |
| Report: |
Reported in EPA TSCA Inventory. |
| Flash Point: | 85.5°C |
| Safety Data | |
 |
|
