| Identification | |
| Name: | 1,4-Benzodioxin,2,3-dihydro-6-nitro- |
| Synonyms: | 1,4-Benzodioxan,6-nitro- (6CI,8CI);2,3-Dihydro-6-nitro-1,4-benzodioxin;6-Nitro-1,4-benzodioxan; |
| CAS: | 16498-20-7 |
| EINECS: | 240-565-2 |
| Molecular Formula: | C8H7NO4 |
| Molecular Weight: | 181.1455 |
| InChI: | InChI=1/C8H7NO4/c10-9(11)6-1-2-7-8(5-6)13-4-3-12-7/h1-2,5H,3-4H2 |
| Molecular Structure: |  |
| Properties | |
| Melting Point: | 120-124 ºC |
| Density: | 1.391 g/cm3 |
| Refractive index: | 1.584 |
| Specification: |
The cas register number of 2,3-Dihydro-6-nitro-1,4-benzodioxin is 16498-20-7. It also can be called as 1,4-Benzodioxin, 2,3-dihydro-6-nitro- and the Systematic name about this chemical is 6-nitro-2,3-dihydro-1,4-benzodioxine. Physical properties about 2,3-Dihydro-6-nitro-1,4-benzodioxin are: (1)ACD/LogP: 2.08; (2)# of Rule of 5 Violations: 0; (3)ACD/LogD (pH 5.5): 2.08; (4)ACD/LogD (pH 7.4): 2.08; (5)ACD/BCF (pH 5.5): 22.59; (6)ACD/BCF (pH 7.4): 22.59; (7)ACD/KOC (pH 5.5): 324.17; (8)ACD/KOC (pH 7.4): 324.17; (9)#H bond acceptors: 5; (10)#H bond donors: 0; (11)#Freely Rotating Bonds: 1; (12)Polar Surface Area: 64.28Å2; (13)Index of Refraction: 1.584; (14)Molar Refractivity: 43.57 cm3; (15)Molar Volume: 130.1 cm3; (16)Surface Tension: 57.2 dyne/cm; (17)Density: 1.391 g/cm3; (18)Flash Point: 150 °C; (19)Enthalpy of Vaporization: 51.55 kJ/mol; (20)Boiling Point: 297.2 °C at 760 mmHg; (21)Vapour Pressure: 0.00243 mmHg at 25°C. People can use the following data to convert to the molecule structure. |
| Safety Data | |
 |
|
