Identification |
Name: | Octadecanoic acid,2-amino-2-oxoethyl ester |
Synonyms: | Stearicacid, ester with glycolamide (8CI); Glycolamido stearate |
CAS: | 16509-77-6 |
EINECS: | 240-576-2 |
Molecular Formula: | C20H39 N O3 |
Molecular Weight: | 341.52856 |
InChI: | InChI=1/C20H39NO3/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-20(23)24-18-19(21)22/h2-18H2,1H3,(H2,21,22) |
Molecular Structure: |
 |
Properties |
Flash Point: | 124.8°C |
Boiling Point: | 469.1°Cat760mmHg |
Density: | 0.94g/cm3 |
Refractive index: | 1.463 |
Flash Point: | 124.8°C |
Safety Data |
|
 |