| Identification | |
| Name: | 1,3-Butadiene,2,3-dichloro- |
| Synonyms: | 2,3-Dichloro-1,3-butadiene;2,3-Dichlorobuta-1,3-diyne; 2,3-Dichlorobutadiene; 2,3-Dichlorobutadiene-1,3;Dichlorobutadiene |
| CAS: | 1653-19-6 |
| EINECS: | 216-721-0 |
| Molecular Formula: | C4H4 Cl2 |
| Molecular Weight: | 122.98 |
| InChI: | InChI=1/C4H4Cl2/c1-3(5)4(2)6/h1-2H2 |
| Molecular Structure: |  |
| Properties | |
| Transport: | 1992 |
| Flash Point: | 37.2°C |
| Boiling Point: | 98°Cat760mmHg |
| Density: | 1.148g/cm3 |
| Refractive index: | 1.461 |
| Specification: |
It is shown that industrially available 2,3-Dichloro-1,3-Butadiene (CAS NO.1653-19-6) is a useful starting material for the synthesis of 2,3-Dichloro-1,3-Butadiene . Ni(II)-catalyzed cross-coupling reaction of 2,3-Dichloro-1,3-Butadiene with ArMgBr (Ar = 2-thi-enyl,phenyl,4-dodecyloxyphenyl,and 4-fluorophenyl) gives the corresponding 2,3-Dichloro-1,3-Butadiene in good yields. |
| Report: |
Reported in EPA TSCA Inventory. |
| Packinggroup: | II |
| Flash Point: | 37.2°C |
| Safety Data | |
 |
|
