| Identification | |
| Name: | 2-Undecanol |
| CAS: | 1653-30-1 |
| EINECS: | 216-722-6 |
| Molecular Formula: | C11H24O |
| Molecular Weight: | 172.3077 |
| InChI: | InChI=1S/C11H24O/c1-3-4-5-6-7-8-9-10-11(2)12/h11-12H,3-10H2,1-2H3 |
| Molecular Structure: |  |
| Properties | |
| Transport: | UN 3082 9/PG 3 |
| Melting Point: | 2-3 °C |
| Flash Point: | 226 °F |
| Boiling Point: | 130-131 °C28 mm Hg(lit.) |
| Density: | 0.828 g/mL at 25 °C(lit.) |
| Refractive index: | n20/D 1.437(lit.) |
| Specification: | clear colorless liquid Safety Statements:26-36-61 26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice 36:Wear suitable protective clothing 61:Avoid release to the environment. Refer to special instructions safety data sheet |
| Flash Point: | 226 °F |
| Safety Data | |
| Hazard Symbols |
Xi: Irritant
N: Dangerous for the environment
|
 |
|
