| Identification | |
| Name: | 1,3-Benzodioxole-5-ethanamine,hydrochloride (1:1) |
| Synonyms: | 1,3-Benzodioxole-5-ethanamine,hydrochloride (9CI); Phenethylamine, 3,4-(methylenedioxy)-, hydrochloride(6CI,7CI,8CI); 2-(3,4-Methylenedioxyphenyl)ethylamine chlorohydrate;2-(3,4-Methylenedioxyphenyl)ethylamine hydrochloride;3,4-(Methylenedioxy)phenylethylamine hydrochloride; 3,4-Methylenedioxy-b-phenylethylamine hydrochloride;3,4-Methylenedioxyphenethylamine hydrochloride;[2-(Benzodioxol-5-yl)ethyl]amine hydrochloride |
| CAS: | 1653-64-1 |
| Molecular Formula: | C9H11 N O2 . Cl H |
| Molecular Weight: | 165.19 |
| InChI: | InChI=1/C9H11NO2.ClH/c10-4-3-7-1-2-8-9(5-7)12-6-11-8;/h1-2,5H,3-4,6,10H2;1H |
| Molecular Structure: |  |
| Properties | |
| Transport: | UN 2811 6.1/PG 2 |
| Melting Point: | 216-218 °C(lit.) |
| Flash Point: | 129.8°C |
| Density: | 1.225 |
| Refractive index: | 1.5620 |
| Specification: | Safety Statements:22-26-36/37/39-45-24/25 22:Do not breathe dust 26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice 36/37/39:Wear suitable protective clothing, gloves and eye/face protection 45:In case of accident or if you feel unwell, seek medical advice immediately (show label where possible) 24/25:Avoid contact with skin and eyes |
| Flash Point: | 129.8°C |
| Safety Data | |
| Hazard Symbols |
T+: Very toxic
Xi: Irritant
|
 |
|
