| Identification |
| Name: | 4-Bromophenylacetonitrile |
| Synonyms: | 4-bromobenzyl cyanide; Benzeneacetonitrile, 4-bromo-; |
| CAS: | 16532-79-9 |
| EINECS: | 240-602-2 |
| Molecular Formula: | C8H6BrN |
| Molecular Weight: | 196.05 |
| InChI: | InChI=1/C8H6BrN/c9-8-3-1-7(2-4-8)5-6-10/h1-4H,5H2 |
| Molecular Structure: |
 |
| Properties |
| Transport: | UN 1694 |
| Boiling Point: | 116-118°C 3mm |
| Density: | 1.487g/cm3 |
| Stability: | Stable under normal temperatures and pressures. |
| Water Solubility: | slightly soluble |
| Solubility: | slightly
soluble AUTOIGNITION |
| Appearance: | clear to yellow
crystals |
| Packinggroup: | III |
| Storage Temperature: | Store in a cool, dry, well-ventilated area away from incompatible substances. Keep containers tightly closed. |
| Safety Data |
| Hazard Symbols |
Xn:Harmful
|
| |
 |
