Identification |
Name: | Zinc(2+),(1,10-phenanthroline-kN1,kN10)- |
Synonyms: | Zinc(2+),(1,10-phenanthroline)-, ion (8CI); Zinc(2+), (1,10-phenanthroline-N1,N10)-;(1,10-Phenanthroline)zinc(2+) |
CAS: | 16561-55-0 |
Molecular Formula: | C12H8 N2 Zn |
Molecular Weight: | 245.59 |
InChI: | InChI=1/C12H8N2.Zn/c1-3-9-5-6-10-4-2-8-14-12(10)11(9)13-7-1;/h1-8H;/q;+2 |
Molecular Structure: |
 |
Properties |
Flash Point: | 164.8°C |
Boiling Point: | 365.1°C at 760 mmHg |
Specification: |
Zinc phenanthroline complex , its cas register number is 16561-55-0. It also can be called Zinc(2+), (1,10-phenanthroline-N1,N10)- (9CI) ; Zinc-1,10-phenanthroline complex ; and Zinc-o-phenanthroline complex .
|
Flash Point: | 164.8°C |
Safety Data |
Hazard Symbols |
|
|
 |