| Identification | |
| Name: | Benzoic acid,1-methylhydrazide, hydrochloride (1:1) |
| Synonyms: | Benzoicacid, 1-methylhydrazide, hydrochloride (7CI);Benzoic acid, 1-methylhydrazide,monohydrochloride (8CI,9CI);N-Methylbenzohydrazide hydrochloride; |
| CAS: | 1660-25-9 |
| Molecular Formula: | C8H10N2O.HCl |
| Molecular Weight: | 186.64 |
| InChI: | InChI=1S/C8H10N2O.ClH/c1-10(9)8(11)7-5-3-2-4-6-7;/h2-6H,9H2,1H3;1H |
| Molecular Structure: |  |
| Properties | |
| Specification: |
The N-Methylbenzohydrazide hydrochloride with the cas number 1660-25-9 is also called Benzoic acid,1-methylhydrazide, hydrochloride (1:1). Its molecular formula is C8H10N2O.HCl. This chemical should be stored in dry and cool environment. Properties Computed from Structure: (1)H-Bond Donor: 2; (2)H-Bond Acceptor: 2; (3)Rotatable Bond Count: 1; (4)Exact Mass: 186.055991; (5)MonoIsotopic Mass: 186.055991; (6)Topological Polar Surface Area: 46.3; (7)Heavy Atom Count: 12; (8)Formal Charge: 0; (9)Complexity: 141; (10)Isotope Atom Count: 0; (11)Defined Atom StereoCenter Count: 0; (12)Undefined Atom StereoCenter Count: 0; (13)Defined Bond StereoCenter Count: 0; (14)Undefined Bond StereoCenter Count: 0; (15)Covalently-Bonded Unit Count: 2. You can still convert the following datas into molecular structure: |
| Safety Data | |
 |
|
