| Identification | |
| Name: | Cyclohexanemethanamine,N,N-dimethyl- |
| Synonyms: | Cyclohexanemethylamine,N,N-dimethyl- (6CI,7CI,8CI); (Cyclohexylmethyl)dimethylamine;N,N-Dimethyl(cyclohexylmethyl)amine; N,N-Dimethyl-N-(cyclohexylmethyl)amine |
| CAS: | 16607-80-0 |
| Molecular Formula: | C9H19 N |
| Molecular Weight: | 141.29 |
| InChI: | InChI=1S/C9H19N/c1-10(2)8-9-6-4-3-5-7-9/h9H,3-8H2,1-2H3 |
| Molecular Structure: |  |
| Properties | |
| Transport: | 2734 |
| Flash Point: | 40.7°C |
| Boiling Point: | 163.9°Cat760mmHg |
| Density: | 0.841g/cm3 |
| Refractive index: | 1.453 |
| Specification: |
1-Cyclohexyltrimethylamine with cas registry number of 16607-80-0 is also known as N,N-dimethylcyclohexanemethylamine ; Trimethylamine,1-cyclohexyl- ; (Cyclohexylmethyl)dimethylamine ; C-C6H11CH2N(CH3)2 ; N,N-Dimethyl-N-cyclohexylmethylamine ; BRN 2689147 ; Cyclohexanemethanamine, N,N-dimethyl- ; LS-157452 ; Cyclohexanemethanamine,N,N-dimethyl- (9CI) ; Cyclohexanemethylamine,N,N-dimethyl- (6CI,7CI,8CI) . 1-Cyclohexyltrimethylamine is used as a pharmaceutical intermediate. |
| Packinggroup: | II |
| Flash Point: | 40.7°C |
| Safety Data | |
 |
|
