Identification |
Name: | Malonyl dichloride |
Synonyms: | Malonylchloride (6CI,7CI,8CI);1,3-Dichloro-1,3-propanedione;Malonic acid chloride;Malonic acid dichloride;Malonoyl dichloride;Malonyldichloride;NSC 66410; |
CAS: | 1663-67-8 |
EINECS: | 216-772-9 |
Molecular Formula: | C3H2Cl2O2 |
Molecular Weight: | 140.95 |
InChI: | InChI=1/C3H2Cl2O2/c4-2(6)1-3(5)7/h1H2 |
Molecular Structure: |
 |
Properties |
Transport: | UN 2920 |
Melting Point: | 53-55ºC |
Density: | 1.449 |
Stability: | Stable at room temperature in closed containers under normal storage and handling conditions. |
Refractive index: | 1.462-1.466 |
Water Solubility: | decomposes |
Solubility: | decomposes |
Appearance: | Orange to brown liquid. Biting odor. |
Packinggroup: | II |
HS Code: | 29171990 |
Storage Temperature: | 2-8°C |
Safety Data |
Hazard Symbols |
C:Corrosive
|
|
 |