| Identification | |
| Name: | Butanal,3-(methylthio)- |
| Synonyms: | Butyraldehyde,3-(methylthio)- (6CI,8CI);3-(Methylthio)butyraldehyde;3-Methylsulfanylbutyraldehyde;b-(Methylthio)butyraldehyde;3-Methylthio butanal; |
| CAS: | 16630-52-7 |
| EINECS: | 240-678-7 |
| Molecular Formula: | C5H10OS |
| Molecular Weight: | 118.1973 |
| InChI: | InChI=1S/C5H10OS/c1-5(7-2)3-4-6/h4-5H,3H2,1-2H3 |
| Molecular Structure: |  |
| Properties | |
| Transport: | 1989 |
| Flash Point: | 62.2 °C |
| Density: | 0.963 g/cm3 |
| Refractive index: | n20/D 1.476(lit.) |
| Water Solubility: | insoluble in water; soluble in alcohol |
| Solubility: | insoluble in water; soluble in alcohol |
| Appearance: | colourless to pale yellow liquid with green, musky, buchu odour |
| Specification: |
3-(Methylthio)butanal (CAS NO.16630-52-7), its Synonyms are 3-(Methylthio)butyraldehyde ; Butanal, 3-(methylthio)- ; Butyraldehyde, 3-(methylthio)- ; beta-(Methylthio)butyraldehyde . |
| Flash Point: | 62.2 °C |
| Sensitive: | Air Sensitive |
| Safety Data | |
| Hazard Symbols |
Xi: Irritant
|
 |
|
