| Identification | |
| Name: | Tetradecanoic acid,2-bromo-, methyl ester |
| Synonyms: | Methyl2-bromo-1-tetradecanoate; |
| CAS: | 16631-25-7 |
| EINECS: | 240-687-6 |
| Molecular Formula: | C15H29BrO2 |
| Molecular Weight: | 321.29356 |
| InChI: | InChI=1S/C15H29BrO2/c1-3-4-5-6-7-8-9-10-11-12-13-14(16)15(17)18-2/h14H,3-13H2,1-2H3 |
| Molecular Structure: |  |
| Properties | |
| Density: | 1.095 |
| Water Solubility: | insoluble in water,Soluble in most organic solvents |
| Solubility: | insoluble in water,Soluble in most organic solvents |
| Appearance: | Clear, yellow to amber viscous liquid |
| Specification: |
Methyl 2-bromotetradecanoate (16631-25-7) is also called Methyl 2-bromomyristate ; Tetradecanoic acid, 2-bromo-, methyl ester ; 2-Bromotetradecanoic acid methyl ester ; Myristate with appearance of light brown liquid. Methyl 2-bromotetradecanoate (16631-25-7) is often used in organic synthesis. |
| Safety Data | |
| Hazard Symbols |
Xi: Irritant
|
 |
|
