| Identification |
| Name: | Acetic-2,2,2-d3 acid,1,1'-anhydride |
| Synonyms: | (Aceticanhydride)-d6 (6CI,8CI); Acetic-d3 acid, anhydride (9CI); Hexadeuterioaceticanhydride; Perdeuterioacetic anhydride; d6-Acetic anhydride |
| CAS: | 16649-49-3 |
| EINECS: | 240-697-0 |
| Molecular Formula: | C4D6 O3 |
| Molecular Weight: | 108.13 |
| InChI: | InChI=1/C4H6O3/c1-3(5)7-4(2)6/h1-2H3/i1D3,2D3 |
| Molecular Structure: |
 |
| Properties |
| Transport: | UN 1715 8/PG 2 |
| Melting Point: | -73 °C(lit.)
|
| Flash Point: | 54.4°C |
| Boiling Point: | 138-140 °C(lit.)
|
| Density: | 1.136g/cm3 |
| Stability: | Stable, but reacts violently with water. Combustible. Incompatible with strong oxidising agents, alcohols, strong bases. |
| Refractive index: | n20/D 1.3875(lit.) |
| Solubility: | appreciable |
| Appearance: | colourless liquid |
| Flash Point: | 54.4°C |
| Storage Temperature: | Flammables area |
| Safety Data |
| |
 |
