| Identification | |
| Name: | L-Tyrosine,O-(phenylmethyl)- |
| Synonyms: | Alanine,3-[p-(benzyloxy)phenyl]-, L- (8CI); NSC 163630; O-Benzyl-L-tyrosine;O-Benzyltyrosine; Tyrosine benzyl ether |
| CAS: | 16652-64-5 |
| EINECS: | 240-699-1 |
| Molecular Formula: | C16H17 N O3 |
| Molecular Weight: | 271.314 |
| InChI: | InChI=1/C16H17NO3/c17-15(16(18)19)10-12-6-8-14(9-7-12)20-11-13-4-2-1-3-5-13/h1-9,15H,10-11,17H2,(H,18,19) |
| Molecular Structure: | ![(C16H17NO3) Alanine,3-[p-(benzyloxy)phenyl]-, L- (8CI); NSC 163630; O-Benzyl-L-tyrosine;O-Benzyltyrosine; Tyrosi...](https://img.guidechem.com/casimg/16652-64-5.gif) |
| Properties | |
| Transport: | OTH |
| Melting Point: | 225 - 230 C (Decomposes) |
| Density: | 1.221 g/cm3 |
| Refractive index: | -10 ° (C=1, 80% AcOH) |
| Solubility: |
Appearance:White to off-white crystalline powder Transport Information: OTH Hazard Symbols:Not regulated UN NO. particular:particular |
| Appearance: | White to off-white crystalline powder |
| Storage Temperature: | Store at RT. |
| Safety Data | |
| Hazard Symbols | |
 |
|
