| Identification | |
| Name: | L-Proline benzyl ester hydrochloride |
| CAS: | 16652-71-4 |
| EINECS: | 240-700-5 |
| Molecular Formula: | C12H15NO2.ClH |
| Molecular Weight: | 241.72 g/mol |
| InChI: | InChI=1S/C12H15NO2/c14-12(11-7-4-8-13-11)15-9-10-5-2-1-3-6-10/h1-3,5-6,11,13H,4,7-9H2 |
| Molecular Structure: |  |
| Properties | |
| Melting Point: | 148-151 oC |
| Flash Point: | 140.7 oC |
| Boiling Point: | 309 oC at 760 mmHg |
| Density: | 1.121g/cm3 |
| Refractive index: | 1.4365 |
| Alpha: | -44 o (C=1, METHANOL) |
| Water Solubility: | MISCIBLE |
| Solubility: | miscible |
| Appearance: | White Crystalline |
| Specification: |
?L-Proline,phenylmethyl ester, hydrochloride (1:1)?, its cas register number is16652-71-4. It also can be called Benzyl 2-pyrrolidinecarboxylate ; Benzyl prolinate ; Proline benzyl ester ; and Proline, phenylmethyl ester . L-Proline,phenylmethyl ester, hydrochloride (1:1)(CAS NO.16652-71-4) absorbs moisture or water from the air. L-Proline,phenylmethyl ester, hydrochloride (1:1) should avoid the condition like incompatible materials, exposure to moist air or water. It is incompatibilities with other materials strong oxidizing agents. Its hazardous decomposition products are hydrogen chloride, chlorine, nitrogen oxides, carbon monoxide, carbon dioxide.?Its hazardous polymerization will not occur. |
| Flash Point: | 140.7 oC |
| Storage Temperature: | Store at RT. |
| Sensitive: | Hygroscopic |
| Safety Data | |
| Hazard Symbols |
Xi: Irritant
Xn: Harmful
|
 |
|
