| Identification | |
| Name: | 5-Fluoro-4-hydrazino-2-methoxypyrimidine |
| Synonyms: | 4(1H)-Pyrimidinone,5-fluoro-2-methoxy-,hydrazone(9CI); |
| CAS: | 166524-64-7 |
| Molecular Formula: | C5H7FN4O |
| Molecular Weight: | 158.13 |
| InChI: | InChI=1/C5H7FN4O/c1-11-5-8-2-3(6)4(9-5)10-7/h2H,7H2,1H3,(H,8,9,10) |
| Molecular Structure: |  |
| Properties | |
| Density: | 1.428g/cm3 |
| Refractive index: | 1.594 |
| Specification: |
The 5-Fluoro-4-hydrazino-2-methoxypyrimidine with cas registry number of 166524-64-7, has the systematic name of 5-fluoro-4-hydrazino-2-methoxypyrimidine. It is also called pyrimidine, 5-fluoro-4-hydrazinyl-2-methoxy-. The 5-Fluoro-4-hydrazino-2-methoxypyrimidine belongs to the following product categorie: halide. Physical properties about this chemical are: (1)ACD/LogP: 0.94; (2)# of Rule of 5 Violations: 0; (3)ACD/LogD (pH 5.5): 0.94; (4)ACD/LogD (pH 7.4): 0.94; (5)ACD/BCF (pH 5.5): 1; (6)ACD/BCF (pH 7.4): 1; (7)ACD/KOC (pH 5.5): 8.79; (8)ACD/KOC (pH 7.4): 8.92; (9)#H bond acceptors: 5; (10)#H bond donors: 3; (11)#Freely Rotating Bonds: 2; (12)Polar Surface Area: 73.06 Å2; (13)Index of Refraction: 1.594; (14)Molar Refractivity: 37.61 cm3; (15)Molar Volume: 110.7 cm3; (16)Polarizability: 14.91×10-24cm3; (17)Surface Tension: 59.4 dyne/cm; (18)Enthalpy of Vaporization: 55.67 kJ/mol; (19)Vapour Pressure: 0.000436 mmHg at 25°C. You can still convert the following datas into molecular structure: |
| Safety Data | |
 |
|
