| Identification | |
| Name: | 4,4'-bis(chloromethyl)-1,1'-biphenyl |
| CAS: | 1667-10-3 |
| EINECS: | 216-784-4 |
| Molecular Formula: | C14H12Cl2 |
| Molecular Weight: | 251.15 |
| InChI: | InChI=1/C14H12Cl2/c15-9-11-1-5-13(6-2-11)14-7-3-12(10-16)4-8-14/h1-8H,9-10H2 |
| Molecular Structure: |  |
| Properties | |
| Transport: | UN 3261 |
| Density: | 1.195g/cm3 |
| Refractive index: | 1.584 |
| Appearance: | white to off-white powder |
| Specification: |
?4,4'-Bis(chloromethyl)-1,1'-biphenyl , its cas register number is 1667-10-3. It also can be called 4,4'-Bis(chloromethyl)biphenyl ; and 1,1'-Biphenyl, 4,4'-bis(chloromethyl)- . |
| Safety Data | |
| Hazard Symbols |
C:Corrosive
|
 |
|
