| Identification | |
| Name: | 4-Chloromethylbiphenyl |
| Synonyms: | Biphenyl,4-(chloromethyl)- (6CI,7CI,8CI);(1,1'-Biphenyl-4-yl)methyl chloride;1-(Chloromethyl)-4-phenylbenzene;4-(Chloromethyl)-1,1'-biphenyl;4-(Chloromethyl)biphenyl;4-Phenylbenzyl chloride;4CMB;NSC 16277;p-Phenylbenzyl chloride; |
| CAS: | 1667-11-4 |
| EINECS: | 216-786-5 |
| Molecular Formula: | C13H11Cl |
| Molecular Weight: | 202.68 |
| InChI: | InChI=1/C13H11Cl/c14-10-11-6-8-13(9-7-11)12-4-2-1-3-5-12/h1-9H,10H2 |
| Molecular Structure: |  |
| Properties | |
| Density: | 1.111 g/cm3 |
| Refractive index: | 1.578 |
| Appearance: | White ro Off-white crystalline powder |
| Specification: |
4-Chloromethylbiphenyl , with CAS number of 1667-11-4, can be called 4-(Chloromethyl)-1'-biphenyl ; 4-(Chloromethyl)-1,1'-biphenyl ; 4-Phenylbenzyl chloride ; p-Phenylbenzyl chloride . |
| Safety Data | |
| Hazard Symbols |
Xi:Irritant
|
 |
|
