| Identification |
| Name: | D-Ornithine monohydrochloride |
| Synonyms: | D-Ornithine,monohydrochloride (9CI);Ornithine, monohydrochloride, D- (8CI);(R)-Ornithinehydrochloride;D-Ornithine,hydrochloride (1:1); |
| CAS: | 16682-12-5 |
| EINECS: | 240-729-3 |
| Molecular Formula: | C5H12N2O2.HCl |
| Molecular Weight: | 168.62 |
| InChI: | InChI=1/C5H12N2O2/c6-3-1-2-4(7)5(8)9/h4H,1-3,6-7H2,(H,8,9) |
| Molecular Structure: |
 |
| Properties |
| Melting Point: | 239 °C (dec.)(lit.)
|
| Flash Point: | 140.5°C |
| Boiling Point: | 308.7°Cat760mmHg |
| Density: | 1.165g/cm3 |
| Stability: | Stable under normal temperatures and pressures. |
| Appearance: | White powder. |
| Flash Point: | 140.5°C |
| Storage Temperature: | Store at RT. |
| Usage: | An amino acid produced in the urea cycle. |
| Safety Data |
| |
 |
