| Identification | |
| Name: | Benzamidine hydrochloride |
| Synonyms: | Benzamidine,hydrochloride (6CI,7CI);Benzamidine, monohydrochloride (8CI);Benzenecarboximidamide, monohydrochloride (9CI);Benzamidinium chloride;Benzenecarboximidamide,hydrochloride (1:1); |
| CAS: | 1670-14-0 |
| EINECS: | 216-795-4 |
| Molecular Formula: | C7H8N2.HCl |
| Molecular Weight: | 156.61 |
| InChI: | InChI=1/C7H8N2.ClH/c8-7(9)6-4-2-1-3-5-6;/h1-5H,(H3,8,9);1H |
| Molecular Structure: |  |
| Properties | |
| Flash Point: | 79.9°C |
| Boiling Point: | 208.5°Cat760mmHg |
| Density: | 1.09g/cm3 |
| Stability: | Stable at room temperature in closed containers under normal storage and handling conditions. |
| Water Solubility: | soluble |
| Solubility: | soluble |
| Appearance: | White to off-white solid. |
| Specification: | white to off-white powder Safety Statements:26-37/39-36 26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice 37/39:Wear suitable protective clothing, gloves and eye/face protection 36:Wear suitable protective clothing |
| Flash Point: | 79.9°C |
| Storage Temperature: | 2-8°C |
| Usage: | Used as a ligand in protein crystallography to prevent proteases from degrading a protein of interest,. |
| Safety Data | |
| Hazard Symbols |
Xi:Irritant
|
 |
|
