| Identification | |
| Name: | Cyclohexane,1,1-diethoxy- |
| Synonyms: | Cyclohexanone,diethyl acetal (6CI,7CI,8CI);1,1-Diethoxycyclohexane;Cyclohexanone diethylketal; |
| CAS: | 1670-47-9 |
| EINECS: | 216-798-0 |
| Molecular Formula: | C10H20O2 |
| Molecular Weight: | 172.266 |
| InChI: | InChI=1/C10H20O2/c1-3-11-10(12-4-2)8-6-5-7-9-10/h3-9H2,1-2H3 |
| Molecular Structure: |  |
| Properties | |
| Transport: | UN 1993 3/PG 3 |
| Flash Point: | 60.2°C |
| Boiling Point: | 206.4°Cat760mmHg |
| Density: | 0.91g/cm3 |
| Refractive index: | n20/D 1.4360(lit.) |
| Appearance: | Clear colorless liquid |
| Specification: | clear colorless liquid Safety Statements:26-36 26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice 36:Wear suitable protective clothing |
| Flash Point: | 60.2°C |
| Safety Data | |
| Hazard Symbols |
Xi: Irritant
|
 |
|
