| Identification | |
| Name: | 1H-Indole-5-carboxamide |
| Synonyms: | Indole-5-carboxamide(7CI,8CI); 5-(Aminocarbonyl)-1H-indole; 5-Carbamoylindole; SD 169 |
| CAS: | 1670-87-7 |
| Molecular Formula: | C9H8 N2 O |
| Molecular Weight: | 160.17262 |
| InChI: | InChI=1/C9H8N2O/c10-9(12)7-1-2-8-6(5-7)3-4-11-8/h1-5,11H,(H2,10,12) |
| Molecular Structure: |  |
| Properties | |
| Melting Point: | 159-163 °C |
| Flash Point: | 230.563°C |
| Boiling Point: | 457.624°C at 760 mmHg |
| Density: | 1.328g/cm3 |
| Refractive index: | 1.717 |
| Specification: | Safety Statements:26 26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice |
| Biological Activity: | Selective, orally active, ATP-competitive inhibitor of p38 α MAPK (IC 50 values are 3.2, 122 and > 50000 nM for p38 α , p38 β and p38 γ respectively). Demonstrates no activity against a range of other kinases including ERK2, JNK1 and MAPKAP2. Prevents development of diabetes and alleviates mild and moderate hyperglycaemic states in NOD mice. |
| Flash Point: | 230.563°C |
| Storage Temperature: | 2-8°C |
| Safety Data | |
| Hazard Symbols |
Xn: Harmful
|
 |
|
