| Identification | |
| Name: | Formamide,N-(2,3-dihydro-1,5-dimethyl-3-oxo-2-phenyl-1H-pyrazol-4-yl)- |
| Synonyms: | Formamide,N-antipyrinyl- (6CI,7CI,8CI); 4-(Formylamino)antipyrine; 4-Formamidoantipyrine;N-Antipyrinylformamide; NSC 60565 |
| CAS: | 1672-58-8 |
| EINECS: | 216-808-3 |
| Molecular Formula: | C12H13 N3 O2 |
| Molecular Weight: | 231.25052 |
| InChI: | InChI=1/C12H13N3O2/c1-9-11(13-8-16)12(17)15(14(9)2)10-6-4-3-5-7-10/h3-8H,1-2H3,(H,13,16) |
| Molecular Structure: |  |
| Properties | |
| Melting Point: | 189-192?C |
| Flash Point: | 195.8°C |
| Boiling Point: | 400.1°Cat760mmHg |
| Density: | 1.29g/cm3 |
| Refractive index: | 1.635 |
| Specification: | Light Tan Solid usageEng:A metabolite of Dipyrone, a nonsteroidal anti-inflammatory drug. |
| Flash Point: | 195.8°C |
| Storage Temperature: | Refrigerator |
| Usage: | A metabolite of Dipyrone, a nonsteroidal anti-inflammatory drug. |
| Safety Data | |
 |
|
