| Identification | |
| Name: | L-Glutamicacid, 5-(phenylmethyl) ester |
| CAS: | 1676-73-9 |
| EINECS: | 216-826-1 |
| Molecular Formula: | C12H15NO4 |
| Molecular Weight: | 237.25 |
| InChI: | InChI=1/C12H15NO4/c13-10(12(15)16)6-7-11(14)17-8-9-4-2-1-3-5-9/h1-5,10H,6-8,13H2,(H,15,16) |
| Molecular Structure: |  |
| Properties | |
| Density: | 1.245 g/cm3 |
| Stability: | Stable under normal temperatures and pressures. |
| Alpha: | 27.2 o (C=2, 1N HCL) |
| Appearance: | white powder |
| Specification: | white powder Safety Statements:22-24/25 22:Do not breathe dust 24/25:Avoid contact with skin and eyes |
| Safety Data | |
 |
|
