| Identification | |
| Name: | 2-Propenoic acid,1,1'-[1,2-ethanediylbis(oxy-2,1-ethanediyl)] ester |
| Synonyms: | Triethylene glycol, diacrylate (8CI);Kayarad PEG 100DA;Light Acrylate 3EG-A;SR 272;2-Propenoicacid, 1,2-ethanediylbis(oxy-2,1-ethanediyl) ester (9CI);Acrylic acid, diesterwith triethylene glycol (6CI,7CI,8CI); |
| CAS: | 1680-21-3 |
| EINECS: | 216-853-9 |
| Molecular Formula: | C12H18O6 |
| Molecular Weight: | 258.27 |
| InChI: | InChI=1/C12H18O6/c1-3-11(13)17-9-7-15-5-6-16-8-10-18-12(14)4-2/h3-4H,1-2,5-10H2 |
| Molecular Structure: |  |
| Properties | |
| Flash Point: | 146.6 ºC |
| Boiling Point: | 338.9 ºCat 760 mmHg |
| Density: | 1.092 g/cm3 |
| Stability: | Stable. Combustible. Incompatible with strong oxidizing agents. |
| Refractive index: | 1.454 |
| Specification: | Safety Statements:26-36/37/39-28 26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice 36/37/39:Wear suitable protective clothing, gloves and eye/face protection 28:After contact with skin, wash immediately with plenty of ... (to be specified by the manufacturer) |
| Report: |
Reported in EPA TSCA Inventory. |
| Flash Point: | 146.6 ºC |
| Safety Data | |
| Hazard Symbols |
Xi: Irritant
|
 |
|
