| Identification | |
| Name: | 4-Pyridinamine,3-nitro- |
| Synonyms: | Pyridine,4-amino-3-nitro- (6CI,7CI,8CI);3-Nitro-4-aminopyridine;3-Nitro-4-pyridinamine; |
| CAS: | 1681-37-4 |
| Molecular Formula: | C5H5N3O2 |
| Molecular Weight: | 139.11 |
| InChI: | InChI=1/C5H5N3O2/c6-4-1-2-7-3-5(4)8(9)10/h1-3H,(H2,6,7)/p+1 |
| Molecular Structure: |  |
| Properties | |
| Flash Point: | 165.7°C |
| Boiling Point: | 350.4°Cat760mmHg |
| Density: | 1.437g/cm3 |
| Appearance: | yellow crystalline powder |
| Specification: | yellow crystalline powder Safety Statements:26-36-36/37/39 26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice 36:Wear suitable protective clothing 36/37/39:Wear suitable protective clothing, gloves and eye/face protection |
| Flash Point: | 165.7°C |
| Safety Data | |
| Hazard Symbols |
Xn:Harmful
|
 |
|
