| Identification | |
| Name: | 2-Oxazolidinone,5,5-dimethyl-4-(phenylmethyl)-, (4S)- |
| Synonyms: | 2-Oxazolidinone,5,5-dimethyl-4-(phenylmethyl)-, (S)-;(4S)-4-Benzyl-5,5-dimethyloxazolidin-2-one; (S)-(-)-4-Benzyl-5,5-dimethyl-2-oxazolidinone;(S)-4-Benzyl-5,5-dimethyloxazolidin-2-one;4S-Benzyl-5,5-dimethyloxazolidin-2-one |
| CAS: | 168297-85-6 |
| Molecular Formula: | C12H15 N O2 |
| Molecular Weight: | 205.253 |
| InChI: | InChI=1/C12H15NO2/c1-12(2)10(13-11(14)15-12)8-9-6-4-3-5-7-9/h3-7,10H,8H2,1-2H3,(H,13,14)/t10-/m0/s1 |
| Molecular Structure: |  |
| Properties | |
| Melting Point: | 65-68ºC(lit.) |
| Flash Point: | 186.7ºC |
| Boiling Point: | 385ºC at 760 mmHg |
| Density: | 1.085 g/cm3 |
| Refractive index: | 1.519 |
| Alpha: | -98 º (C=2 IN CHLOROFORM) |
| Water Solubility: | at 25 deg C (mg/L): 154.5 |
| Solubility: | at 25 deg C (mg/L): 154.5 |
| Specification: |
(S)-(-)-4-Benzyl-5,5-dimethyl-2-oxazolidinone ,its cas register number is 168297-85-6.It also can be called 2-oxazolidinone, 5,5-dimethyl-4-(phenylmethyl)-, (4S)- ; (4S)-4-benzyl-5,5-dimethyl-1,3-oxazolidin-2-one and (S)-4-Benzyl-5,5-Dimethyl-Oxazolidin-2-One . |
| Flash Point: | 186.7ºC |
| Safety Data | |
| Hazard Symbols |
Xi: Irritant
|
 |
|
