| Identification |
| Name: | COMPOUND 401 |
| Synonyms: | 2-(Morpholin-4-yl)-4H-pyrimido[2,1-a]isoquinolin-4-one;4H-Pyrimido[2,1-a]isoquinolin-4-one, 2-(4-morpholinyl)- |
| CAS: | 168425-64-7 |
| Molecular Formula: | C16H15N3O2 |
| Molecular Weight: | 281.314 |
| InChI: | InChI=1/C16H15N3O2/c20-15-11-14(18-7-9-21-10-8-18)17-16-13-4-2-1-3-12(13)5-6-19(15)16/h1-6,11H,7-10H2 |
| Molecular Structure: |
![(C16H15N3O2) 2-(Morpholin-4-yl)-4H-pyrimido[2,1-a]isoquinolin-4-one;4H-Pyrimido[2,1-a]isoquinolin-4-one, 2-(4-mor...](https://img.guidechem.com/structure/168425-64-7.gif) |
| Properties |
| Flash Point: | 230.135°C |
| Boiling Point: | 456.916°C at 760 mmHg |
| Density: | 1.364g/cm3 |
| Refractive index: | 1.695 |
| Biological Activity: | Reversible and selective inhibitor of DNA-dependent protein kinase (DNA-PK) and mammalian target of rapamycin (mTOR) (IC 50 values are 0.28 and 5.3 μ M respectively). Displays little affinity for other commonly studied kinases including PI 3-K, ATM and ATR (IC 50 values are all > 100 μ M). Induces apoptosis in vitro . |
| Flash Point: | 230.135°C |
| Safety Data |
| |
 |
