| Identification | |
| Name: | 1H-Indole, 3-chloro- |
| Synonyms: | Indole,3-chloro- (6CI,8CI);3-Chloroindole;3-Chloro-1H-indole; |
| CAS: | 16863-96-0 |
| Molecular Formula: | C8H6 Cl N |
| Molecular Weight: | 151.59 |
| InChI: | InChI=1/C8H6ClN/c9-8-5-6-3-1-2-4-7(6)10-8/h1-5,10H |
| Molecular Structure: |  |
| Properties | |
| Density: | 1.331 g/cm3 |
| Refractive index: | 1.688 |
| Specification: |
The 3-Chloro-1H-indole with the CAS number 16863-96-0 is also called 1H-Indole, 3-chloro-. Its molecular formula is C8H6ClN. This chemical belongs to the following product categories: (1)indole; (2)Indoles and derivatives. It should be stored in dry and cool environment. The properties of the chemical are: (1)ACD/LogP:2.74; (2)# of Rule of 5 Violations:0 ; (3)#H bond acceptors:1; (4)#H bond donors:1; (5)#Freely Rotating Bonds:0; (6)Polar Surface Area:4.93 Å2; (7)Index of Refraction:1.688; (8)Molar Refractivity:43.42 cm3; (9)Molar Volume:113.8 cm3; (10)Polarizability:17.21×10-24cm3; (11)Surface Tension:52.6 dyne/cm; (12)Enthalpy of Vaporization:51.13 kJ/mol; (13)Vapour Pressure:0.00309 mmHg at 25°C. You can still convert the following datas into molecular structure: |
| Safety Data | |
 |
|
