| Identification |
| Name: | 2-Furancarboxylicacid, tetrahydro- |
| Synonyms: | 2-Furoicacid, tetrahydro- (6CI,7CI,8CI);(R,S)-Tetrahydrofuran-2-carboxylic acid;NSC 521564;Tetrahydro-2-furancarboxylic acid;Tetrahydro-2-furoic acid; |
| CAS: | 16874-33-2 |
| Molecular Formula: | C5H8O3 |
| Molecular Weight: | 116.12 |
| InChI: | InChI=1/C5H8O3/c6-5(7)4-2-1-3-8-4/h4H,1-3H2,(H,6,7) |
| Molecular Structure: |
 |
| Properties |
| Transport: | UN 3265 8 |
| Melting Point: | 21 |
| Density: | 1.17 |
| Stability: | Stable under normal temperatures and pressures. |
| Refractive index: | 1.459-1.461 |
| Water Solubility: | soluble |
| Solubility: | Soluble in water |
| Appearance: | Colorless to light yellow liqui |
| Packinggroup: | III |
| HS Code: | 29321900 |
| Storage Temperature: | Store in a cool, dry, well-ventilated area away from incompatible substances. Corrosives area. Keep containers tightly closed. |
| Safety Data |
| Hazard Symbols |
C:Corrosive
|
| |
 |
