| Identification | |
| Name: | 5-Methyl-3-phenylisoxazole-4-carbonyl chloride |
| Synonyms: | 5-Methyl-3-phenyl-1,2-oxazole-4-carbonyl chloride |
| CAS: | 16883-16-2 |
| EINECS: | 240-915-4 |
| Molecular Formula: | C11H8ClNO2 |
| Molecular Weight: | 221.64 |
| InChI: | InChI=1/C11H8ClNO2/c1-7-9(11(12)14)10(13-15-7)8-5-3-2-4-6-8/h2-6H,1H3 |
| Molecular Structure: |  |
| Properties | |
| Transport: | UN3261 |
| Flash Point: | 371.9°Cat760mmHg |
| Boiling Point: | 371.9°Cat760mmHg |
| Density: | 1.27 |
| Refractive index: | 1.562 |
| Specification: |
4-Isoxazolecarbonylchloride, 5-methyl-3-phenyl- , its cas register number is 16883-16-2. It also can be called 3-phenyl-5-methylisoxazole-4-carbonyl chloride ; 5-Methyl-3-phenyl-1,2-oxazole-4-carbonyl chloride . 4-Isoxazolecarbonylchloride, 5-methyl-3-phenyl- (CAS NO.16883-16-2) is harmful if swallowed. And it may cause burns. |
| Packinggroup: | II |
| Flash Point: | 371.9°Cat760mmHg |
| Sensitive: | Moisture Sensitive |
| Safety Data | |
| Hazard Symbols |
C:Corrosive
|
 |
|
